EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N2O3S |
| Net Charge | 0 |
| Average Mass | 222.310 |
| Monoisotopic Mass | 222.10381 |
| SMILES | CCCCS(=N)(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
| InChIKey | KJQFBVYMGADDTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) is a homocysteines (CHEBI:24610) |
| 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) is a sulfoximide (CHEBI:38084) |
| Incoming Relation(s) |
| D-buthionine-(S,R)-sulfoximine (CHEBI:176509) is a 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) |
| L-buthionine-(S,R)-sulfoximine (CHEBI:94288) is a 2-amino-4-(S-butylsulfonimidoyl)butanoic acid (CHEBI:176510) |
| IUPAC Name |
|---|
| 2-amino-4-(S-butylsulfonimidoyl)butanoic acid |
| Synonym | Source |
|---|---|
| 2-amino-4-(S-butylsulfonimidoyl)butyric acid | ChEBI |