EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O5S |
| Net Charge | 0 |
| Average Mass | 300.296 |
| Monoisotopic Mass | 300.05284 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)O)[C@](C)(Cn1ccnn1)S2(=O)=O |
| InChI | InChI=1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
| InChIKey | LPQZKKCYTLCDGQ-WEDXCCLWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazobactam (CHEBI:9421) has functional parent sulbactam (CHEBI:9321) |
| tazobactam (CHEBI:9421) has role antiinfective agent (CHEBI:35441) |
| tazobactam (CHEBI:9421) has role antimicrobial agent (CHEBI:33281) |
| tazobactam (CHEBI:9421) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| tazobactam (CHEBI:9421) is a penicillanic acids (CHEBI:25865) |
| tazobactam (CHEBI:9421) is a triazoles (CHEBI:35727) |
| tazobactam (CHEBI:9421) is conjugate acid of tazobactam(1−) (CHEBI:85193) |
| Incoming Relation(s) |
| tazobactam(1−) (CHEBI:85193) is conjugate base of tazobactam (CHEBI:9421) |
| IUPAC Name |
|---|
| (2S,3S,5R)-3-methyl-4,4,7-trioxo-3-[(1H-1,2,3-triazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| INNs | Source |
|---|---|
| tazobactam | ChemIDplus |
| tazobactamum | ChemIDplus |
| Synonym | Source |
|---|---|
| (2S,3S,5S)-3-methyl-7-oxo-3-(1H-1,2,3-triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4787944 | Reaxys |
| CAS:89786-04-9 | KEGG COMPOUND |
| CAS:89786-04-9 | ChemIDplus |
| Citations |
|---|