EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O5S |
| Net Charge | -1 |
| Average Mass | 299.288 |
| Monoisotopic Mass | 299.04556 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)[O-])[C@](C)(Cn1ccnn1)S2(=O)=O |
| InChI | InChI=1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/p-1/t7-,8+,10+/m1/s1 |
| InChIKey | LPQZKKCYTLCDGQ-WEDXCCLWSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazobactam(1−) (CHEBI:85193) is a penicillinate anion (CHEBI:51356) |
| tazobactam(1−) (CHEBI:85193) is conjugate base of tazobactam (CHEBI:9421) |
| Incoming Relation(s) |
| tazobactam sodium (CHEBI:85192) has part tazobactam(1−) (CHEBI:85193) |
| tazobactam (CHEBI:9421) is conjugate acid of tazobactam(1−) (CHEBI:85193) |
| IUPAC Name |
|---|
| (2S,3S,5R)-3-methyl-4,4,7-trioxo-3-[(1H-1,2,3-triazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonym | Source |
|---|---|
| tazobactam anion | ChEBI |