EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO5S |
| Net Charge | 0 |
| Average Mass | 233.245 |
| Monoisotopic Mass | 233.03579 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)O)C(C)(C)S2(=O)=O |
| InChI | InChI=1S/C8H11NO5S/c1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| InChIKey | FKENQMMABCRJMK-RITPCOANSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulbactam (CHEBI:9321) is a penicillanic acids (CHEBI:25865) |
| sulbactam (CHEBI:9321) is conjugate acid of sulbactam(1−) (CHEBI:229543) |
| Incoming Relation(s) |
| sultamicillin (CHEBI:51770) has functional parent sulbactam (CHEBI:9321) |
| tazobactam (CHEBI:9421) has functional parent sulbactam (CHEBI:9321) |
| sulbactam(1−) (CHEBI:229543) is conjugate base of sulbactam (CHEBI:9321) |
| IUPAC Name |
|---|
| 2,2-dimethyl-1,1-dioxidopenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| sulbactam | WHO MedNet |
| sulbactam | WHO MedNet |
| sulbactam | WHO MedNet |
| sulbactamum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid 4,4-dioxide | ChemIDplus |
| (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide | IUPAC |
| CP 45899 | DrugBank |
| CP-45899 | DrugBank |
| CP45899 | DrugBank |
| penicillanic acid 1,1-dioxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4192832 | Beilstein |
| CAS:68373-14-8 | KEGG COMPOUND |
| CAS:68373-14-8 | ChemIDplus |
| CAS:69388-84-7 | KEGG COMPOUND |
| Citations |
|---|