EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68329 - syringic acid
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | COc1cc(C(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
| InChIKey | JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringic acid (CHEBI:68329) has functional parent gallic acid (CHEBI:30778) |
| syringic acid (CHEBI:68329) has role plant metabolite (CHEBI:76924) |
| syringic acid (CHEBI:68329) is a benzoic acids (CHEBI:22723) |
| syringic acid (CHEBI:68329) is a dimethoxybenzene (CHEBI:51681) |
| syringic acid (CHEBI:68329) is a phenols (CHEBI:33853) |
| syringic acid (CHEBI:68329) is conjugate acid of syringate (CHEBI:132111) |
| Incoming Relation(s) |
| methyl syringate (CHEBI:45820) has functional parent syringic acid (CHEBI:68329) |
| syringic acid acetate (CHEBI:86946) has functional parent syringic acid (CHEBI:68329) |
| syringate (CHEBI:132111) is conjugate base of syringic acid (CHEBI:68329) |
| IUPAC Name |
|---|
| 4-hydroxy-3,5-dimethoxybenzoic acid |
| Synonyms | Source |
|---|---|
| Cedar acid | ChEBI |
| Gallic acid 3,5-dimethyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10833 | KEGG COMPOUND |
| C00002674 | KNApSAcK |
| LSM-19009 | LINCS |
| Syringic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2115262 | Reaxys |
| CAS:530-57-4 | KEGG COMPOUND |
| CAS:530-57-4 | ChemIDplus |
| Citations |
|---|