EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:45820 - methyl syringate
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COC(=O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C10H12O5/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5,11H,1-3H3 |
| InChIKey | ZMXJAEGJWHJMGX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Buxus natalensis (IPNI:128681-1) | bark (BTO:0001301) | PubMed (20954721) | MeOH extract of pulverized bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl syringate (CHEBI:45820) has functional parent syringic acid (CHEBI:68329) |
| methyl syringate (CHEBI:45820) has role plant metabolite (CHEBI:76924) |
| methyl syringate (CHEBI:45820) is a benzoate ester (CHEBI:36054) |
| methyl syringate (CHEBI:45820) is a dimethoxybenzene (CHEBI:51681) |
| methyl syringate (CHEBI:45820) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 4-hydroxy-3,5-dimethoxybenzoate |
| Synonym | Source |
|---|---|
| Syringic acid monomethyl ester | NIST Chemistry WebBook |
| Citations |
|---|