EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C11H12O6/c1-6(12)17-10-8(15-2)4-7(11(13)14)5-9(10)16-3/h4-5H,1-3H3,(H,13,14) |
| InChIKey | VEJHIZHVFWVWRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringic acid acetate (CHEBI:86946) has functional parent syringic acid (CHEBI:68329) |
| syringic acid acetate (CHEBI:86946) is a benzoic acids (CHEBI:22723) |
| syringic acid acetate (CHEBI:86946) is a dimethoxybenzene (CHEBI:51681) |
| syringic acid acetate (CHEBI:86946) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| 4-(acetyloxy)-3,5-dimethoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 4-acetoxy-3,5-dimethoxybenzoic acid | ChEBI |
| acetylsyringic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2814631 | Reaxys |