EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClN5O7PS |
| Net Charge | -1 |
| Average Mass | 486.810 |
| Monoisotopic Mass | 486.00456 |
| SMILES | Nc1nc(=O)c2nc(Sc3ccc(Cl)cc3)n([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H15ClN5O7PS/c17-6-1-3-7(4-2-6)31-16-19-9-12(20-15(18)21-13(9)24)22(16)14-10(23)11-8(28-14)5-27-30(25,26)29-11/h1-4,8,10-11,14,23H,5H2,(H,25,26)(H3,18,20,21,24)/p-1/t8-,10-,11-,14-/m1/s1 |
| InChIKey | ZDJHIEHUVPCEDK-IDTAVKCVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) is a organophosphate oxoanion (CHEBI:58945) |
| 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) is conjugate base of 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) |
| Incoming Relation(s) |
| 8-(4-chlorophenylthio)-cGMP·Na (CHEBI:91237) has part 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is conjugate acid of 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) |
| Synonyms | Source |
|---|---|
| 8-(4-chlorophenylthio)-3',5'-cyclic GMP(1−) | ChEBI |
| sodium 8-(4-chlorophenylthio)guanosine 3',5'-cyclic phosphate(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8175275 | Reaxys |