EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15ClN5O7PS |
| Net Charge | 0 |
| Average Mass | 487.818 |
| Monoisotopic Mass | 487.01183 |
| SMILES | Nc1nc(=O)c2nc(Sc3ccc(Cl)cc3)n([C@@H]3O[C@@H]4COP(=O)(O)O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H15ClN5O7PS/c17-6-1-3-7(4-2-6)31-16-19-9-12(20-15(18)21-13(9)24)22(16)14-10(23)11-8(28-14)5-27-30(25,26)29-11/h1-4,8,10-11,14,23H,5H2,(H,25,26)(H3,18,20,21,24)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | ZDJHIEHUVPCEDK-IDTAVKCVSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) has functional parent 3',5'-cyclic GMP (CHEBI:16356) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) has role protein kinase agonist (CHEBI:64106) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is a aryl sulfide (CHEBI:35683) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is a organochlorine compound (CHEBI:36683) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is a ribonucleotide (CHEBI:26561) |
| 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) is conjugate acid of 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) |
| Incoming Relation(s) |
| 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) is conjugate base of 8-(4-chlorophenylthio)-cGMP (CHEBI:84638) |
| IUPAC Name |
|---|
| 2-amino-8-[(4-chlorophenyl)sulfanyl]-9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxotetrahydro-2H,4H-2λ5-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 8-(4-chlorophenylthio)-3',5'-cyclic GMP | ChEBI |
| 8-(4-chlorophenylthio)-cyclic GMP | ChEBI |
| 8-pCPT-cGMP | ChEBI |
| 8-(4-chlorophenylthio)guanosine 3',5'-cyclic monophosphate | ChEBI |
| 8-(4-chlorophenylthio)guanosine 3',5'-cyclic phosphate | ChEBI |
| 8-((4-Chlorophenyl)thio)cyclic-3',5'-GMP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1199328 | Reaxys |
| CAS:54364-02-2 | ChemIDplus |
| Citations |
|---|