EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClN5O7PS.Na |
| Net Charge | 0 |
| Average Mass | 509.800 |
| Monoisotopic Mass | 508.99378 |
| SMILES | Nc1nc(=O)c2nc(Sc3ccc(Cl)cc3)n([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]4[C@H]3O)c2n1.[Na+] |
| InChI | InChI=1S/C16H15ClN5O7PS.Na/c17-6-1-3-7(4-2-6)31-16-19-9-12(20-15(18)21-13(9)24)22(16)14-10(23)11-8(28-14)5-27-30(25,26)29-11;/h1-4,8,10-11,14,23H,5H2,(H,25,26)(H3,18,20,21,24);/q;+1/p-1/t8-,10-,11-,14-;/m1./s1 |
| InChIKey | REEQGIQRCDWDRA-ZBMQJGODSA-M |
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(4-chlorophenylthio)-cGMP·Na (CHEBI:91237) has part 8-(4-chlorophenylthio)-cGMP(1−) (CHEBI:91239) |
| 8-(4-chlorophenylthio)-cGMP·Na (CHEBI:91237) has role protein kinase agonist (CHEBI:64106) |
| 8-(4-chlorophenylthio)-cGMP·Na (CHEBI:91237) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (4aR,6R,7R,7aS)-6-{2-amino-8-[(4-chlorophenyl)sulfanyl]-6-oxo-1,6-dihydro-9H-purin-9-yl}-7-hydroxy-2-oxotetrahydro-2H,4H-2λ5-furo[3,2-d][1,3,2]dioxaphosphinin-2-olate |
| Synonyms | Source |
|---|---|
| 8-(4-chlorophenylthio)-3',5'-cyclic GMP·Na | ChEBI |
| 8-pCPT-cGMP·Na | ChEBI |
| sodium 8-(4-chlorophenylthio)guanosine 3',5'-cyclic monophosphate | ChEBI |
| sodium 8-(4-chlorophenylthio)guanosine 3',5'-cyclic phosphate | ChEBI |