EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O3 |
| Net Charge | 0 |
| Average Mass | 348.402 |
| Monoisotopic Mass | 348.14739 |
| SMILES | [H][C@]12Cc3c4[n-]c5ccccc5c4cc[n+]3C[C@]1([H])[C@H](C)OC=C2C(=O)OC |
| InChI | InChI=1S/C21H20N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-8,11-12,15-16H,9-10H2,1-2H3/t12-,15-,16+/m0/s1 |
| InChIKey | WYTGDNHDOZPMIW-VBNZEHGJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serpentine (CHEBI:9119) has parent hydride 18-oxayohimban (CHEBI:35638) |
| serpentine (CHEBI:9119) is a carboxylic ester (CHEBI:33308) |
| serpentine (CHEBI:9119) is a iminium betaine (CHEBI:35285) |
| serpentine (CHEBI:9119) is a indole alkaloid (CHEBI:38958) |
| serpentine (CHEBI:9119) is a quinolizines (CHEBI:38063) |
| serpentine (CHEBI:9119) is a zwitterion (CHEBI:27369) |
| serpentine (CHEBI:9119) is conjugate base of serpentine(1+) (CHEBI:142531) |
| Incoming Relation(s) |
| serpentine(1+) (CHEBI:142531) is conjugate acid of serpentine (CHEBI:9119) |
| IUPAC Name |
|---|
| methyl (19α)-19-methyl-3,4,5,6,16,17-hexadehydro-18-oxayohimban-4-ium-1-ide-16-carboxylate |
| Synonyms | Source |
|---|---|
| (19α)-3,4,5,6,16,17-hexadehydro-16-(methoxycarbonyl)-19-methyloxayohimbanium | ChemIDplus |
| (4S,4aR,14aS)-4-methyl-1-[(methyloxy)carbonyl]-4a,5,14,14a-tetrahydro-4H-indolo[2,3-a]pyrano[3,4-g]quinolizin-6-ium-13-ide | IUPAC |
| methyl (19α)-19-methyl-3,4,5,6,16,17-hexadehydrooxayohimban-4-ium-1-ide-16-carboxylate | IUPAC |
| Serpentine | KEGG COMPOUND |
| Serpentine (alkaloid) | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5421116 | Beilstein |
| CAS:18786-24-8 | KEGG COMPOUND |
| CAS:18786-24-8 | ChemIDplus |