EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O |
| Net Charge | 0 |
| Average Mass | 282.387 |
| Monoisotopic Mass | 282.17321 |
| SMILES | [H][C@@]12COCC[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C18H22N2O/c1-2-4-16-14(3-1)15-5-7-20-10-13-11-21-8-6-12(13)9-17(20)18(15)19-16/h1-4,12-13,17,19H,5-11H2/t12-,13+,17-/m0/s1 |
| InChIKey | GAGIJETXYAHUIP-AHIWAGSCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-oxayohimban (CHEBI:35638) is a indole alkaloid (CHEBI:38958) |
| 18-oxayohimban (CHEBI:35638) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| serpentine (CHEBI:9119) has parent hydride 18-oxayohimban (CHEBI:35638) |
| IUPAC Name |
|---|
| 18-oxayohimban |
| Synonyms | Source |
|---|---|
| oxayohimban | IUPAC |
| (4aR,13bS,14aR)-1,2,4a,5,7,8,13,13b,14,14a-decahydro-4H-indolo[2,3-a]pyrano[3,4-g]quinolizine | IUPAC |