EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N2O3 |
| Net Charge | +1 |
| Average Mass | 349.410 |
| Monoisotopic Mass | 349.15467 |
| SMILES | [H][C@]12Cc3c4nc5ccccc5c4cc[n+]3C[C@]1([H])[C@H](C)OC=C2C(=O)OC |
| InChI | InChI=1S/C21H20N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-8,11-12,15-16H,9-10H2,1-2H3/p+1/t12-,15-,16+/m0/s1 |
| InChIKey | WYTGDNHDOZPMIW-VBNZEHGJSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serpentine(1+) (CHEBI:142531) is a organic cation (CHEBI:25697) |
| serpentine(1+) (CHEBI:142531) is conjugate acid of serpentine (CHEBI:9119) |
| Incoming Relation(s) |
| serpentine (CHEBI:9119) is conjugate base of serpentine(1+) (CHEBI:142531) |
| UniProt Name | Source |
|---|---|
| serpentine | UniProt |