EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H28NO3 |
| Net Charge | 0 |
| Average Mass | 398.341 |
| Monoisotopic Mass | 397.12526 |
| SMILES | C[N+]1(C)CC[C@H](OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1.[Br-] |
| InChI | InChI=1S/C19H28NO3.BrH/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H/q+1;/p-1/t17-,19-;/m0./s1 |
| InChIKey | VPNYRYCIDCJBOM-QQTWVUFVSA-M |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-glycopyrronium bromide (CHEBI:90974) is a glycopyrronium bromide (CHEBI:90972) |
| (2R,3S)-glycopyrronium bromide (CHEBI:90974) is enantiomer of (2S,3R)-glycopyrronium bromide (CHEBI:90973) |
| Incoming Relation(s) |
| ritropirronium bromide (CHEBI:5494) has part (2R,3S)-glycopyrronium bromide (CHEBI:90974) |
| (2S,3R)-glycopyrronium bromide (CHEBI:90973) is enantiomer of (2R,3S)-glycopyrronium bromide (CHEBI:90974) |
| IUPAC Name |
|---|
| (3S)-3-{[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]oxy}-1,1-dimethylpyrrolidin-1-ium bromide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9826108 | Reaxys |
| Citations |
|---|