EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H28NO3 |
| Net Charge | 0 |
| Average Mass | 398.341 |
| Monoisotopic Mass | 397.12526 |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1.[Br-] |
| InChI | InChI=1S/C19H28NO3.BrH/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VPNYRYCIDCJBOM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycopyrronium bromide (CHEBI:90972) has role anti-asthmatic agent (CHEBI:65023) |
| glycopyrronium bromide (CHEBI:90972) has role antidepressant (CHEBI:35469) |
| glycopyrronium bromide (CHEBI:90972) has role renoprotective agent (CHEBI:231911) |
| glycopyrronium bromide (CHEBI:90972) is a organic bromide salt (CHEBI:48369) |
| glycopyrronium bromide (CHEBI:90972) is a quaternary ammonium salt (CHEBI:35273) |
| Incoming Relation(s) |
| (2R,3S)-glycopyrronium bromide (CHEBI:90974) is a glycopyrronium bromide (CHEBI:90972) |
| (2S,3R)-glycopyrronium bromide (CHEBI:90973) is a glycopyrronium bromide (CHEBI:90972) |
| IUPAC Name |
|---|
| 3-{[cyclopentyl(hydroxy)phenylacetyl]oxy}-1,1-dimethylpyrrolidin-1-ium bromide |
| INNs | Source |
|---|---|
| bromure de glycopyrronium | ChemIDplus |
| bromuro de glicopirronio | ChemIDplus |
| glycopyrronii bromidum | ChemIDplus |
| glycopyrronium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,1-Dimethyl-3-hydroxypyrrolidinium bromide alpha-cyclopentylmandelate | ChemIDplus |
| 1-Methyl-3-pyrrolidyl alpha-phenylcyclopentaneglycolate methobromide | ChemIDplus |
| 3-Hydroxy-1,1-dimethylpyrrolidinium bromide alpha-cyclopentylmandelate | ChemIDplus |
| AD-237 | ChEMBL |
| AHR-504 | ChEMBL |
| CHF-5259 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cuvposa | ChEMBL |
| Dartisla odt | ChEMBL |
| Enurev breezhaler | ChEMBL |
| Glycopyrrolate component of prevduo | ChEMBL |
| Glycopyrrolate component of utibron | ChEMBL |
| Glycopyrronium bromide component of bevespi aerosphere glycopyrrolate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3642926 | Reaxys |
| CAS:596-51-0 | ChemIDplus |
| Citations |
|---|