EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19BCl2N2O4 |
| Net Charge | 0 |
| Average Mass | 361.034 |
| Monoisotopic Mass | 360.08149 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B(O)O |
| InChI | InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | MXAYKZJJDUDWDS-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ixazomib (CHEBI:90942) has role anti-anaemic agent (CHEBI:75835) |
| ixazomib (CHEBI:90942) has role anti-HIV agent (CHEBI:64946) |
| ixazomib (CHEBI:90942) has role anti-inflammatory agent (CHEBI:67079) |
| ixazomib (CHEBI:90942) has role antineoplastic agent (CHEBI:35610) |
| ixazomib (CHEBI:90942) has role apoptosis inducer (CHEBI:68495) |
| ixazomib (CHEBI:90942) has role drug metabolite (CHEBI:49103) |
| ixazomib (CHEBI:90942) has role orphan drug (CHEBI:71031) |
| ixazomib (CHEBI:90942) has role proteasome inhibitor (CHEBI:52726) |
| ixazomib (CHEBI:90942) is a benzamides (CHEBI:22702) |
| ixazomib (CHEBI:90942) is a boronic acids (CHEBI:38269) |
| ixazomib (CHEBI:90942) is a dichlorobenzene (CHEBI:23697) |
| ixazomib (CHEBI:90942) is a glycine derivative (CHEBI:24373) |
| Incoming Relation(s) |
| ixazomib citrate (CHEBI:90939) has functional parent ixazomib (CHEBI:90942) |
| IUPAC Name |
|---|
| N-[(1R)-1-borono-3-methylbutyl]-N2-(2,5-dichlorobenzoyl)glycinamide |
| INN | Source |
|---|---|
| ixazomib | ChemIDplus |
| Synonyms | Source |
|---|---|
| MLN 2238 | ChemIDplus |
| MLN-2238 | ChemIDplus |
| MLN2238 | ChemIDplus |
| MLN-9708 FREE BASE | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18302358 | Reaxys |
| CAS:1072833-77-2 | ChemIDplus |
| CAS:1072833-77-2 | KEGG DRUG |
| Citations |
|---|