EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19BCl2N2O4 |
| Net Charge | 0 |
| Average Mass | 361.034 |
| Monoisotopic Mass | 360.08149 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B(O)O |
| InChI | InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | MXAYKZJJDUDWDS-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ixazomib (CHEBI:90942) has role antineoplastic agent (CHEBI:35610) |
| ixazomib (CHEBI:90942) has role apoptosis inducer (CHEBI:68495) |
| ixazomib (CHEBI:90942) has role drug metabolite (CHEBI:49103) |
| ixazomib (CHEBI:90942) has role orphan drug (CHEBI:71031) |
| ixazomib (CHEBI:90942) has role proteasome inhibitor (CHEBI:52726) |
| ixazomib (CHEBI:90942) is a benzamides (CHEBI:22702) |
| ixazomib (CHEBI:90942) is a boronic acids (CHEBI:38269) |
| ixazomib (CHEBI:90942) is a dichlorobenzene (CHEBI:23697) |
| ixazomib (CHEBI:90942) is a glycine derivative (CHEBI:24373) |
| Incoming Relation(s) |
| ixazomib citrate (CHEBI:90939) has functional parent ixazomib (CHEBI:90942) |
| IUPAC Name |
|---|
| N-[(1R)-1-borono-3-methylbutyl]-N2-(2,5-dichlorobenzoyl)glycinamide |
| INN | Source |
|---|---|
| ixazomib | ChemIDplus |
| Synonyms | Source |
|---|---|
| MLN 2238 | ChemIDplus |
| MLN-2238 | ChemIDplus |
| MLN2238 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18302358 | Reaxys |
| CAS:1072833-77-2 | KEGG DRUG |
| CAS:1072833-77-2 | ChemIDplus |
| Citations |
|---|