EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23BCl2N2O9 |
| Net Charge | 0 |
| Average Mass | 517.127 |
| Monoisotopic Mass | 516.08737 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(=O)C(CC(=O)O)(CC(=O)O)O1 |
| InChI | InChI=1S/C20H23BCl2N2O9/c1-10(2)5-14(21-33-19(32)20(34-21,7-16(27)28)8-17(29)30)25-15(26)9-24-18(31)12-6-11(22)3-4-13(12)23/h3-4,6,10,14H,5,7-9H2,1-2H3,(H,24,31)(H,25,26)(H,27,28)(H,29,30)/t14-/m0/s1 |
| InChIKey | MBOMYENWWXQSNW-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ixazomib citrate (CHEBI:90939) has functional parent ixazomib (CHEBI:90942) |
| ixazomib citrate (CHEBI:90939) has role antineoplastic agent (CHEBI:35610) |
| ixazomib citrate (CHEBI:90939) has role apoptosis inducer (CHEBI:68495) |
| ixazomib citrate (CHEBI:90939) has role orphan drug (CHEBI:71031) |
| ixazomib citrate (CHEBI:90939) has role prodrug (CHEBI:50266) |
| ixazomib citrate (CHEBI:90939) has role proteasome inhibitor (CHEBI:52726) |
| ixazomib citrate (CHEBI:90939) is a 1,3,2-dioxaborolane (CHEBI:51636) |
| ixazomib citrate (CHEBI:90939) is a benzamides (CHEBI:22702) |
| ixazomib citrate (CHEBI:90939) is a dichlorobenzene (CHEBI:23697) |
| ixazomib citrate (CHEBI:90939) is a glycine derivative (CHEBI:24373) |
| ixazomib citrate (CHEBI:90939) is a oxo dicarboxylic acid (CHEBI:36145) |
| IUPAC Name |
|---|
| 2,2'-{2-[(1R)-1-{[N-(2,5-dichlorobenzoyl)glycyl]amino}-3-methylbutyl]-5-oxo-1,3,2-dioxaborolane-4,4-diyl}diacetic acid |
| Synonyms | Source |
|---|---|
| MLN 9708 | ChemIDplus |
| MLN9708 | ChemIDplus |
| Brand Name | Source |
|---|---|
| NINLARO | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27723083 | Reaxys |
| CAS:1239908-20-3 | ChemIDplus |
| CAS:1239908-20-3 | KEGG DRUG |
| Citations |
|---|