EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N6O5P |
| Net Charge | +1 |
| Average Mass | 477.482 |
| Monoisotopic Mass | 477.20098 |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(CO[C@H](C)Cn1cnc2c([NH3+])ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C21H29N6O5P/c1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24)/p+1/t15-,16+,33+/m1/s1 |
| InChIKey | LDEKQSIMHVQZJK-CAQYMETFSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir alafenamide(1+) (CHEBI:90927) is a ammonium ion derivative (CHEBI:35274) |
| tenofovir alafenamide(1+) (CHEBI:90927) is a organic cation (CHEBI:25697) |
| tenofovir alafenamide(1+) (CHEBI:90927) is conjugate acid of tenofovir alafenamide (CHEBI:90926) |
| Incoming Relation(s) |
| tenofovir alafenamide fumarate (CHEBI:90923) has part tenofovir alafenamide(1+) (CHEBI:90927) |
| tenofovir alafenamide (CHEBI:90926) is conjugate base of tenofovir alafenamide(1+) (CHEBI:90927) |
| Synonym | Source |
|---|---|
| tenofovir alafenamide cation | ChEBI |