EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C21H29N6O5P.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 1069.020 |
| Monoisotopic Mass | 1068.39837 |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1.CC(C)OC(=O)[C@H](C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C21H29N6O5P.C4H4O4/c2*1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27;5-3(6)1-2-4(7)8/h2*5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24);1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*15-,16+,33+;/m11./s1 |
| InChIKey | SVUJNSGGPUCLQZ-FQQAACOVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir alafenamide fumarate (CHEBI:90923) has part tenofovir alafenamide(1+) (CHEBI:90927) |
| tenofovir alafenamide fumarate (CHEBI:90923) has role antiviral drug (CHEBI:36044) |
| tenofovir alafenamide fumarate (CHEBI:90923) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir alafenamide fumarate (CHEBI:90923) has role prodrug (CHEBI:50266) |
| tenofovir alafenamide fumarate (CHEBI:90923) is a fumarate salt (CHEBI:50921) |
| Incoming Relation(s) |
| Descovy (CHEBI:133007) has part tenofovir alafenamide fumarate (CHEBI:90923) |
| Genvoya (CHEBI:90922) has part tenofovir alafenamide fumarate (CHEBI:90923) |
| Odefsey (CHEBI:133010) has part tenofovir alafenamide fumarate (CHEBI:90923) |
| IUPAC Names |
|---|
| bis{propan-2-yl N-[(S)-({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)(phenoxy)phosphoryl]-L-alaninate} (2E)-but-2-enedioate |
| bis{9-[(2R,5S,7E)-2,7,10-trimethyl-5,8-dioxo-5-phenoxy-3,9-dioxa-6-aza-5λ5-phosphaundecan-1-yl]-9H-purin-6-aminium} (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| GS-7340-03 | ChemIDplus |
| TAF | ChemIDplus |
| tenofovir alafenamide hemifumarate | ChEBI |
| Brand Name | Source |
|---|---|
| Vemlidy | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10605 | KEGG DRUG |
| Tenofovir_alafenamide | Wikipedia |
| DB09299 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23336042 | Reaxys |
| CAS:1392275-56-7 | KEGG DRUG |
| CAS:1392275-56-7 | ChemIDplus |
| Citations |
|---|