EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N6O5P |
| Net Charge | 0 |
| Average Mass | 476.474 |
| Monoisotopic Mass | 476.19370 |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C21H29N6O5P/c1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24)/t15-,16+,33+/m1/s1 |
| InChIKey | LDEKQSIMHVQZJK-CAQYMETFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir alafenamide (CHEBI:90926) has functional parent adenine (CHEBI:16708) |
| tenofovir alafenamide (CHEBI:90926) has role antiviral drug (CHEBI:36044) |
| tenofovir alafenamide (CHEBI:90926) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| tenofovir alafenamide (CHEBI:90926) has role prodrug (CHEBI:50266) |
| tenofovir alafenamide (CHEBI:90926) is a L-alanine derivative (CHEBI:83943) |
| tenofovir alafenamide (CHEBI:90926) is a 6-aminopurines (CHEBI:20706) |
| tenofovir alafenamide (CHEBI:90926) is a ether (CHEBI:25698) |
| tenofovir alafenamide (CHEBI:90926) is a isopropyl ester (CHEBI:35725) |
| tenofovir alafenamide (CHEBI:90926) is a phosphoramidate ester (CHEBI:27577) |
| tenofovir alafenamide (CHEBI:90926) is conjugate base of tenofovir alafenamide(1+) (CHEBI:90927) |
| Incoming Relation(s) |
| tenofovir alafenamide(1+) (CHEBI:90927) is conjugate acid of tenofovir alafenamide (CHEBI:90926) |
| IUPAC Name |
|---|
| propan-2-yl N-[(S)-({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)(phenoxy)phosphoryl]-L-alaninate |
| INN | Source |
|---|---|
| tenofovir alafenamide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| GS-7340 | ChemIDplus |
| TAF | ChemIDplus |
| GS 7340 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10428 | KEGG DRUG |
| Tenofovir_alafenamide | Wikipedia |
| DB09299 | DrugBank |
| 4944 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8948831 | Reaxys |
| CAS:379270-37-8 | KEGG DRUG |
| CAS:379270-37-8 | ChemIDplus |