EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27F6N2O2 |
| Net Charge | +1 |
| Average Mass | 501.491 |
| Monoisotopic Mass | 501.19712 |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@]2(CCC(=O)N2)C[NH2+]1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F6N2O2/c1-16(17-11-19(24(26,27)28)13-20(12-17)25(29,30)31)35-15-23(18-5-3-2-4-6-18)10-9-22(14-32-23)8-7-21(34)33-22/h2-6,11-13,16,32H,7-10,14-15H2,1H3,(H,33,34)/p+1/t16-,22-,23-/m1/s1 |
| InChIKey | FIVSJYGQAIEMOC-ZGNKEGEESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolapitant(1+) (CHEBI:90913) is a ammonium ion derivative (CHEBI:35274) |
| rolapitant(1+) (CHEBI:90913) is a organic cation (CHEBI:25697) |
| rolapitant(1+) (CHEBI:90913) is conjugate acid of rolapitant (CHEBI:90908) |
| Incoming Relation(s) |
| rolapitant hydrochloride (anhydrous) (CHEBI:90912) has part rolapitant(1+) (CHEBI:90913) |
| rolapitant (CHEBI:90908) is conjugate base of rolapitant(1+) (CHEBI:90913) |
| IUPAC Name |
|---|
| (5S,8S)-8-({(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}methyl)-2-oxo-8-phenyl-1,7-diazaspiro[4.5]decan-7-ium |
| Synonym | Source |
|---|---|
| rolapitant cation | ChEBI |