EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26F6N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 536.944 |
| Monoisotopic Mass | 536.16653 |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@]2(CCC(=O)N2)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C25H26F6N2O2.ClH/c1-16(17-11-19(24(26,27)28)13-20(12-17)25(29,30)31)35-15-23(18-5-3-2-4-6-18)10-9-22(14-32-23)8-7-21(34)33-22;/h2-6,11-13,16,32H,7-10,14-15H2,1H3,(H,33,34);1H/t16-,22-,23-;/m1./s1 |
| InChIKey | VEWAWEMXVUFANV-PVBCUUEWSA-N |
| Roles Classification |
|---|
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolapitant hydrochloride (anhydrous) (CHEBI:90912) has part rolapitant(1+) (CHEBI:90913) |
| rolapitant hydrochloride (anhydrous) (CHEBI:90912) has role antiemetic (CHEBI:50919) |
| rolapitant hydrochloride (anhydrous) (CHEBI:90912) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| rolapitant hydrochloride (anhydrous) (CHEBI:90912) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| rolapitant hydrochloride hydrate (CHEBI:90911) has part rolapitant hydrochloride (anhydrous) (CHEBI:90912) |
| IUPAC Names |
|---|
| (5S,8S)-8-({(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}methyl)-8-phenyl-1,7-diazaspiro[4.5]decan-2-one hydrochloride |
| (5S,8S)-8-({(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}methyl)-2-oxo-8-phenyl-1,7-diazaspiro[4.5]decan-7-ium chloride |
| Synonyms | Source |
|---|---|
| rolapitant monohydrochloride | ChEBI |
| rolapitant.HCl | ChEBI |
| rolapitant hydrochloride | ChEBI |
| Rolapitant hydrochloride anhydrous | ChemIDplus |
| SCH619734 | ChemIDplus |
| SCH 619734 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15570171 | Reaxys |
| CAS:858102-79-1 | ChemIDplus |
| Citations |
|---|