EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26F6N2O2 |
| Net Charge | 0 |
| Average Mass | 500.483 |
| Monoisotopic Mass | 500.18985 |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@]2(CCC(=O)N2)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F6N2O2/c1-16(17-11-19(24(26,27)28)13-20(12-17)25(29,30)31)35-15-23(18-5-3-2-4-6-18)10-9-22(14-32-23)8-7-21(34)33-22/h2-6,11-13,16,32H,7-10,14-15H2,1H3,(H,33,34)/t16-,22-,23-/m1/s1 |
| InChIKey | FIVSJYGQAIEMOC-ZGNKEGEESA-N |
| Roles Classification |
|---|
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolapitant (CHEBI:90908) has role antiemetic (CHEBI:50919) |
| rolapitant (CHEBI:90908) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| rolapitant (CHEBI:90908) is a azaspiro compound (CHEBI:35624) |
| rolapitant (CHEBI:90908) is a ether (CHEBI:25698) |
| rolapitant (CHEBI:90908) is a organofluorine compound (CHEBI:37143) |
| rolapitant (CHEBI:90908) is a piperidines (CHEBI:26151) |
| rolapitant (CHEBI:90908) is a pyrrolidin-2-ones (CHEBI:74223) |
| rolapitant (CHEBI:90908) is conjugate base of rolapitant(1+) (CHEBI:90913) |
| Incoming Relation(s) |
| rolapitant(1+) (CHEBI:90913) is conjugate acid of rolapitant (CHEBI:90908) |
| IUPAC Name |
|---|
| (5S,8S)-8-({(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy}methyl)-8-phenyl-1,7-diazaspiro[4.5]decan-2-one |
| INN | Source |
|---|---|
| rolapitant | KEGG DRUG |
| Synonyms | Source |
|---|---|
| SCH 619734 | ChemIDplus |
| SCH-619734 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15570068 | Reaxys |
| CAS:552292-08-7 | ChemIDplus |
| CAS:552292-08-7 | KEGG DRUG |
| Citations |
|---|