EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12ClN4O2 |
| Net Charge | +1 |
| Average Mass | 243.674 |
| Monoisotopic Mass | 243.06433 |
| SMILES | [NH2+]=C1CCCN1Cc1nc(=O)nc(=O)c1Cl |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-5(12-9(16)13-8(7)15)4-14-3-1-2-6(14)11/h11H,1-4H2,(H2,12,13,15,16)/p+1 |
| InChIKey | QQHMKNYGKVVGCZ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipiracil(1+) (CHEBI:90880) is a carboxamidinium ion (CHEBI:77718) |
| tipiracil(1+) (CHEBI:90880) is conjugate acid of tipiracil (CHEBI:90879) |
| Incoming Relation(s) |
| tipiracil hydrochloride (CHEBI:90877) has part tipiracil(1+) (CHEBI:90880) |
| tipiracil (CHEBI:90879) is conjugate base of tipiracil(1+) (CHEBI:90880) |
| IUPAC Name |
|---|
| 1-[(5-chloro-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)methyl]pyrrolidin-2-iminium |
| Synonym | Source |
|---|---|
| tipiracil cation | ChEBI |