EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90879 - tipiracil
| Formula | C9H11ClN4O2 |
| Net Charge | 0 |
| Average Mass | 242.666 |
| Monoisotopic Mass | 242.05705 |
| SMILES | N=C1CCCN1Cc1nc(=O)nc(=O)c1Cl |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-5(12-9(16)13-8(7)15)4-14-3-1-2-6(14)11/h11H,1-4H2,(H2,12,13,15,16) |
| InChIKey | QQHMKNYGKVVGCZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.4.2.4 (thymidine phosphorylase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of thymidine phosphorylase (EC 2.4.2.4). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipiracil (CHEBI:90879) has functional parent uracil (CHEBI:17568) |
| tipiracil (CHEBI:90879) has role antineoplastic agent (CHEBI:35610) |
| tipiracil (CHEBI:90879) has role EC 2.4.2.4 (thymidine phosphorylase) inhibitor (CHEBI:90878) |
| tipiracil (CHEBI:90879) is a carboxamidine (CHEBI:35359) |
| tipiracil (CHEBI:90879) is a organochlorine compound (CHEBI:36683) |
| tipiracil (CHEBI:90879) is a pyrimidone (CHEBI:38337) |
| tipiracil (CHEBI:90879) is a pyrrolidines (CHEBI:38260) |
| tipiracil (CHEBI:90879) is conjugate base of tipiracil(1+) (CHEBI:90880) |
| Incoming Relation(s) |
| tipiracil(1+) (CHEBI:90880) is conjugate acid of tipiracil (CHEBI:90879) |
| IUPAC Name |
|---|
| 5-chloro-6-[(2-iminopyrrolidin-1-yl)methyl]pyrimidine-2,4(1H,3H)-dione |
| INN | Source |
|---|---|
| tipiracil | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9272220 | Reaxys |
| CAS:183204-74-2 | ChemIDplus |
| Citations |
|---|