EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90877 - tipiracil hydrochloride
| Formula | C9H11ClN4O2.HCl |
| Net Charge | 0 |
| Average Mass | 279.127 |
| Monoisotopic Mass | 278.03373 |
| SMILES | Cl.N=C1CCCN1Cc1nc(=O)nc(=O)c1Cl |
| InChI | InChI=1S/C9H11ClN4O2.ClH/c10-7-5(12-9(16)13-8(7)15)4-14-3-1-2-6(14)11;/h11H,1-4H2,(H2,12,13,15,16);1H |
| InChIKey | KGHYQYACJRXCAT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.4.2.4 (thymidine phosphorylase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of thymidine phosphorylase (EC 2.4.2.4). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipiracil hydrochloride (CHEBI:90877) has part tipiracil(1+) (CHEBI:90880) |
| tipiracil hydrochloride (CHEBI:90877) has role antineoplastic agent (CHEBI:35610) |
| tipiracil hydrochloride (CHEBI:90877) has role EC 2.4.2.4 (thymidine phosphorylase) inhibitor (CHEBI:90878) |
| tipiracil hydrochloride (CHEBI:90877) is a hydrochloride (CHEBI:36807) |
| tipiracil hydrochloride (CHEBI:90877) is a iminium salt (CHEBI:35277) |
| Incoming Relation(s) |
| Lonsurf (CHEBI:90876) has part tipiracil hydrochloride (CHEBI:90877) |
| IUPAC Names |
|---|
| 1-[(5-chloro-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)methyl]pyrrolidin-2-iminium chloride |
| 5-chloro-6-[(2-iminopyrrolidin-1-yl)methyl]pyrimidine-2,4(1H,3H)-dione hydrochloride |
| Synonyms | Source |
|---|---|
| tipiracil.HCl | ChemIDplus |
| tipiracil monohydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9299131 | Reaxys |
| CAS:183204-72-0 | KEGG DRUG |
| CAS:183204-72-0 | ChemIDplus |
| Citations |
|---|