EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O3 |
| Net Charge | 0 |
| Average Mass | 419.525 |
| Monoisotopic Mass | 419.22089 |
| SMILES | CC(C)N(CCCCOCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H29N3O3/c1-19(2)28(15-9-10-16-31-18-23(29)30)22-17-26-24(20-11-5-3-6-12-20)25(27-22)21-13-7-4-8-14-21/h3-8,11-14,17,19H,9-10,15-16,18H2,1-2H3,(H,29,30) |
| InChIKey | OJQMKCBWYCWFPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | prostacyclin receptor agonist An agonist that binds to and activates prostacyclin receptors |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ACT-333679 (CHEBI:90848) has role drug metabolite (CHEBI:49103) |
| ACT-333679 (CHEBI:90848) has role orphan drug (CHEBI:71031) |
| ACT-333679 (CHEBI:90848) has role platelet aggregation inhibitor (CHEBI:50427) |
| ACT-333679 (CHEBI:90848) has role prostacyclin receptor agonist (CHEBI:90845) |
| ACT-333679 (CHEBI:90848) has role vasodilator agent (CHEBI:35620) |
| ACT-333679 (CHEBI:90848) is a aromatic amine (CHEBI:33860) |
| ACT-333679 (CHEBI:90848) is a ether (CHEBI:25698) |
| ACT-333679 (CHEBI:90848) is a monocarboxylic acid (CHEBI:25384) |
| ACT-333679 (CHEBI:90848) is a pyrazines (CHEBI:38314) |
| ACT-333679 (CHEBI:90848) is a sulfonamide (CHEBI:35358) |
| ACT-333679 (CHEBI:90848) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| selexipag (CHEBI:90844) has functional parent ACT-333679 (CHEBI:90848) |
| IUPAC Name |
|---|
| {4-[(5,6-diphenylpyrazin-2-yl)(propan-2-yl)amino]butoxy}acetic acid |
| Synonyms | Source |
|---|---|
| ACT 333679 | ChemIDplus |
| ACT333679 | ChEBI |
| MRE 269 | ChemIDplus |
| MRE-269 | ChemIDplus |
| MRE269 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11140228 | Reaxys |
| CAS:475085-57-5 | ChemIDplus |
| Citations |
|---|