EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N4O4S |
| Net Charge | 0 |
| Average Mass | 496.633 |
| Monoisotopic Mass | 496.21443 |
| SMILES | CC(C)N(CCCCOCC(=O)NS(C)(=O)=O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H32N4O4S/c1-20(2)30(16-10-11-17-34-19-24(31)29-35(3,32)33)23-18-27-25(21-12-6-4-7-13-21)26(28-23)22-14-8-5-9-15-22/h4-9,12-15,18,20H,10-11,16-17,19H2,1-3H3,(H,29,31) |
| InChIKey | QXWZQTURMXZVHJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | prostacyclin receptor agonist An agonist that binds to and activates prostacyclin receptors |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selexipag (CHEBI:90844) has functional parent ACT-333679 (CHEBI:90848) |
| selexipag (CHEBI:90844) has role orphan drug (CHEBI:71031) |
| selexipag (CHEBI:90844) has role platelet aggregation inhibitor (CHEBI:50427) |
| selexipag (CHEBI:90844) has role prodrug (CHEBI:50266) |
| selexipag (CHEBI:90844) has role prostacyclin receptor agonist (CHEBI:90845) |
| selexipag (CHEBI:90844) has role vasodilator agent (CHEBI:35620) |
| selexipag (CHEBI:90844) is a N-sulfonylcarboxamide (CHEBI:90852) |
| selexipag (CHEBI:90844) is a aromatic amine (CHEBI:33860) |
| selexipag (CHEBI:90844) is a ether (CHEBI:25698) |
| selexipag (CHEBI:90844) is a monocarboxylic acid amide (CHEBI:29347) |
| selexipag (CHEBI:90844) is a pyrazines (CHEBI:38314) |
| selexipag (CHEBI:90844) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-{4-[(5,6-diphenylpyrazin-2-yl)(propan-2-yl)amino]butoxy}-N-(methanesulfonyl)acetamide |
| INN | Source |
|---|---|
| selexipag | KEGG DRUG |
| Synonyms | Source |
|---|---|
| ACT-293987 | ChemIDplus |
| NS 304 | ChemIDplus |
| NS-304 | ChemIDplus |
| ACT 293987 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Uptravi | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11140227 | Reaxys |
| CAS:475086-01-2 | KEGG DRUG |
| CAS:475086-01-2 | ChemIDplus |
| Citations |
|---|