EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N2O8P |
| Net Charge | -2 |
| Average Mass | 334.221 |
| Monoisotopic Mass | 334.05770 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)C=CC1 |
| InChI | InChI=1S/C11H17N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1,3-4,7-9,11,14-15H,2,5H2,(H2,12,16)(H2,17,18,19)/p-2/t7-,8-,9-,11-/m1/s1 |
| InChIKey | XQHMUSRSLNRVGA-TURQNECASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NMNH(2−) (CHEBI:90832) has functional parent NMN+ (CHEBI:14648) |
| NMNH(2−) (CHEBI:90832) is a organophosphate oxoanion (CHEBI:58945) |
| NMNH(2−) (CHEBI:90832) is conjugate base of NMNH (CHEBI:74452) |
| Incoming Relation(s) |
| NMNH (CHEBI:74452) is conjugate acid of NMNH(2−) (CHEBI:90832) |
| UniProt Name | Source |
|---|---|
| reduced β-nicotinamide D-ribonucleotide | UniProt |