EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N2O8P |
| Net Charge | 0 |
| Average Mass | 336.237 |
| Monoisotopic Mass | 336.07225 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)C=CC1 |
| InChI | InChI=1S/C11H17N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1,3-4,7-9,11,14-15H,2,5H2,(H2,12,16)(H2,17,18,19)/t7-,8-,9-,11-/m1/s1 |
| InChIKey | XQHMUSRSLNRVGA-TURQNECASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NMNH (CHEBI:74452) has functional parent NMN+ (CHEBI:14648) |
| NMNH (CHEBI:74452) has role metabolite (CHEBI:25212) |
| NMNH (CHEBI:74452) is a nicotinamide mononucleotide (CHEBI:50383) |
| NMNH (CHEBI:74452) is conjugate acid of NMNH(2−) (CHEBI:90832) |
| Incoming Relation(s) |
| NMNH(2−) (CHEBI:90832) is conjugate base of NMNH (CHEBI:74452) |
| IUPAC Name |
|---|
| 1-(5-O-phosphono-β-D-ribofuranosyl)-1,4-dihydropyridine-3-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:497113 | Reaxys |