EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O8P |
| Net Charge | +1 |
| Average Mass | 335.229 |
| Monoisotopic Mass | 335.06388 |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/p+1/t7-,8-,9-,11-/m1/s1 |
| InChIKey | DAYLJWODMCOQEW-TURQNECASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NMN+ (CHEBI:14648) is a nicotinamide mononucleotide (CHEBI:50383) |
| NMN+ (CHEBI:14648) is conjugate acid of NMN zwitterion (CHEBI:16171) |
| Incoming Relation(s) |
| NMNH (CHEBI:74452) has functional parent NMN+ (CHEBI:14648) |
| NMNH(2−) (CHEBI:90832) has functional parent NMN+ (CHEBI:14648) |
| NMN zwitterion (CHEBI:16171) is conjugate base of NMN+ (CHEBI:14648) |
| IUPAC Name |
|---|
| 3-carbamoyl-1-(5-O-phosphono-β-D-ribofuranosyl)pyridinium |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4158043 | Beilstein |