EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:90779 - S-substituted glutathione(1−)
| Formula | C10H15N3O6SR |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 305.309 |
| Monoisotopic Mass (excl. R groups) | 305.06816 |
| SMILES | *SC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-substituted glutathione(1−) (CHEBI:90779) has functional parent glutathionate(1−) (CHEBI:57925) |
| S-substituted glutathione(1−) (CHEBI:90779) is a peptide anion (CHEBI:60334) |
| S-substituted glutathione(1−) (CHEBI:90779) is conjugate base of S-substituted glutathione (CHEBI:17021) |
| Incoming Relation(s) |
| (E)-1-(glutathion-S-yl)-2-(indol-3-yl)acetohydroximate(1−) (CHEBI:136444) is a S-substituted glutathione(1−) (CHEBI:90779) |
| (E)-1-(glutathione-S-yl)-ω-(methylthio)alkylhydroximate(1−) (CHEBI:136061) is a S-substituted glutathione(1−) (CHEBI:90779) |
| (Z)-1-(glutathione-S-yl)-2-phenylacetohydroximate(1−) (CHEBI:136447) is a S-substituted glutathione(1−) (CHEBI:90779) |
| (4E)-3-(glutathion-S-yl)dec-4-enal(1-) (CHEBI:760722) is a S-substituted glutathione(1−) (CHEBI:90779) |
| (4E)-3-(glutathion-S-yl)non-4-enal(1-) (CHEBI:760721) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-(1-hydroxy-2-methylbut-3-en-2-yl)glutathione(1−) (CHEBI:131718) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-(2-methyl-1-oxobut-3-en-2-yl)glutathione(1−) (CHEBI:131798) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-(2,4-dinitrophenyl)glutathione(1−) (CHEBI:133977) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-[(2E,6E,10E)-geranylgeranyl]-L-glutathione(1−) (CHEBI:156326) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-adenosylglutathione(1−) (CHEBI:146184) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-methyl glutathione(1−) (CHEBI:141467) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-methylthio glutathione(1−) (CHEBI:141468) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 2-(glutathion-S-yl)-1,4-hydroquinone(1−) (CHEBI:134616) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 2‐[2,3‐dichloro‐4‐(2‐(methylglutathion-S-yl)butanoyl)phenoxy]acetate(2-) (CHEBI:760757) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 3-(glutathion-S-yl)-4-hydroxynonanal(1−) (CHEBI:234318) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 3-(glutathion-S-yl)nonanal(1-) (CHEBI:760724) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 3-(glutathion-S-yl)octanal(1-) (CHEBI:760723) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-(1-methylnaphthyl)glutathione (CHEBI:760686) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-hexylglutathione(1-) (CHEBI:760759) is a S-substituted glutathione(1−) (CHEBI:90779) |
| S-substituted glutathione (CHEBI:17021) is conjugate acid of S-substituted glutathione(1−) (CHEBI:90779) |
| UniProt Name | Source |
|---|---|
| an S-substituted glutathione | UniProt |