EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760686 - S-(1-methylnaphthyl)glutathione
| Formula | C21H24N3O7S |
| Net Charge | -1 |
| Average Mass | 462.504 |
| Monoisotopic Mass | 462.13404 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](CSOCc1cccc2ccccc12)C(=O)NCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C21H25N3O7S/c22-16(21(29)30)8-9-18(25)24-17(20(28)23-10-19(26)27)12-32-31-11-14-6-3-5-13-4-1-2-7-15(13)14/h1-7,16-17H,8-12,22H2,(H,23,28)(H,24,25)(H,26,27)(H,29,30)/p-1/t16-,17-/m0/s1 |
| InChIKey | FMABROISWYZUNA-IRXDYDNUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(1-methylnaphthyl)glutathione (CHEBI:760686) is a S-substituted glutathione(1−) (CHEBI:90779) |
| UniProt Name | Source |
|---|---|
| S-(1-methylnaphthyl)glutathione | UniProt |
| Citations |
|---|