EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760724 - 3-(glutathion-S-yl)nonanal(1-)
| Formula | C19H32N3O7S |
| Net Charge | -1 |
| Average Mass | 446.546 |
| Monoisotopic Mass | 446.19664 |
| SMILES | [H]C(=O)CC(CCCCCC)SC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C19H33N3O7S/c1-2-3-4-5-6-13(9-10-23)30-12-15(18(27)21-11-17(25)26)22-16(24)8-7-14(20)19(28)29/h10,13-15H,2-9,11-12,20H2,1H3,(H,21,27)(H,22,24)(H,25,26)(H,28,29)/p-1/t13?,14-,15-/m0/s1 |
| InChIKey | TYPBCGOOKFMEPX-FGRDXJNISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(glutathion-S-yl)nonanal(1-) (CHEBI:760724) is a S-substituted glutathione(1−) (CHEBI:90779) |
| 3-(glutathion-S-yl)nonanal(1-) (CHEBI:760724) is a fatty aldehyde (CHEBI:35746) |
| UniProt Name | Source |
|---|---|
| 3-(glutathion-S-yl)nonanal | UniProt |
| Citations |
|---|