EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28ClNO6 |
| Net Charge | 0 |
| Average Mass | 401.887 |
| Monoisotopic Mass | 401.16052 |
| SMILES | [H][C@]1([C@@]2(C)O[C@]2([H])CC=C(C)C)[C@H](OC)[C@H](OC(=O)NC(=O)CCl)CC[C@]12CO2 |
| InChI | InChI=1S/C19H28ClNO6/c1-11(2)5-6-13-18(3,27-13)16-15(24-4)12(7-8-19(16)10-25-19)26-17(23)21-14(22)9-20/h5,12-13,15-16H,6-10H2,1-4H3,(H,21,22,23)/t12-,13-,15-,16-,18+,19+/m1/s1 |
| InChIKey | MSHZHSPISPJWHW-PVDLLORBSA-N |
| Roles Classification |
|---|
| Biological Roles: | retinoic acid receptor alpha antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor α. methionine aminopeptidase 2 inhibitor Any methionyl aminopeptidase inhibitor that inhibits the action of methionyl aminopeptidase 2. EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. retinoic acid receptor alpha antagonist A retinoic acid receptor antagonist that antagonises retinoic acid receptor α. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has functional parent fumagillol (CHEBI:324935) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has role angiogenesis inhibitor (CHEBI:48422) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has role antineoplastic agent (CHEBI:35610) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has role methionine aminopeptidase 2 inhibitor (CHEBI:73361) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has role retinoic acid receptor α antagonist (CHEBI:90713) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) is a carbamate ester (CHEBI:23003) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) is a organochlorine compound (CHEBI:36683) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) is a semisynthetic derivative (CHEBI:72588) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) is a sesquiterpenoid (CHEBI:26658) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-en-1-yl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl (chloroacetyl)carbamate |
| Synonyms | Source |
|---|---|
| (CHLOROACETYL)CARBAMIC ACID (3R,4S,5S,5R)-5-METHOXY-4-[(2R,3R)-2-METHYL-3-(3-METHYL-2-BUTENYL)OXIRANYL]-1-OXASPIRO[2.5]OCT-6-YL ESTER | PDBeChem |
| Agm 1470 | ChemIDplus |
| O-chloroacetylcarbamoylfumagillol | ChemIDplus |
| AGM-1470 | ChEBI |
| DRG-0148 | ChemIDplus |
| TNP-470 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5358869 | Reaxys |
| CAS:129298-91-5 | ChemIDplus |
| Citations |
|---|