EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O4 |
| Net Charge | 0 |
| Average Mass | 282.380 |
| Monoisotopic Mass | 282.18311 |
| SMILES | [H][C@]1([C@@]2(C)O[C@]2([H])CC=C(C)C)[C@H](OC)[C@H](O)CC[C@]12CO2 |
| InChI | InChI=1S/C16H26O4/c1-10(2)5-6-12-15(3,20-12)14-13(18-4)11(17)7-8-16(14)9-19-16/h5,11-14,17H,6-9H2,1-4H3/t11-,12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | CEVCTNCUIVEQOY-JQOWZUPLSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumagillol (CHEBI:324935) has role antimicrobial agent (CHEBI:33281) |
| fumagillol (CHEBI:324935) is a secondary alcohol (CHEBI:35681) |
| fumagillol (CHEBI:324935) is a sesquiterpenoid (CHEBI:26658) |
| fumagillol (CHEBI:324935) is a spiro-epoxide (CHEBI:133131) |
| Incoming Relation(s) |
| O-(chloroacetylcarbamoyl)fumagillol (CHEBI:90748) has functional parent fumagillol (CHEBI:324935) |
| fumagillin (CHEBI:48635) has functional parent fumagillol (CHEBI:324935) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-en-1-yl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
| UniProt Name | Source |
|---|---|
| fumagillol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5340842 | Beilstein |
| CAS:108102-51-8 | ChemIDplus |
| Citations |
|---|