EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11Cl2F3N2O2 |
| Net Charge | 0 |
| Average Mass | 415.198 |
| Monoisotopic Mass | 414.01497 |
| SMILES | O=C(O)/C=C/c1nn(Cc2ccc(Cl)cc2Cl)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c19-12-3-1-10(14(20)8-12)9-25-16-7-11(18(21,22)23)2-4-13(16)15(24-25)5-6-17(26)27/h1-8H,9H2,(H,26,27)/b6-5+ |
| InChIKey | KYYQMVUKYQCSQY-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | eukaryotic translation elongation factor 1alpha 1 inhibitor Any compound that inihibits the human protein, eukaryotic translation elongation factor 1α 1. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamendazole (CHEBI:90703) has functional parent lonidamine (CHEBI:50138) |
| gamendazole (CHEBI:90703) has role antispermatogenic agent (CHEBI:145047) |
| gamendazole (CHEBI:90703) has role eukaryotic translation elongation factor 1α 1 inhibitor (CHEBI:90767) |
| gamendazole (CHEBI:90703) has role Hsp90 inhibitor (CHEBI:63962) |
| gamendazole (CHEBI:90703) has role synthetic oral contraceptive (CHEBI:49326) |
| gamendazole (CHEBI:90703) is a dichlorobenzene (CHEBI:23697) |
| gamendazole (CHEBI:90703) is a indazoles (CHEBI:38769) |
| gamendazole (CHEBI:90703) is a olefinic compound (CHEBI:78840) |
| gamendazole (CHEBI:90703) is a organofluorine compound (CHEBI:37143) |
| gamendazole (CHEBI:90703) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-3-{1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-3-yl}prop-2-enoic acid |
| Synonym | Source |
|---|---|
| trans-3-(1-benzyl-6-(trifluoromethyl)-1H-indazol-3-yl)acrylic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Gamendazole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12542895 | Reaxys |
| Citations |
|---|