EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 321.163 |
| Monoisotopic Mass | 320.01193 |
| SMILES | O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21/h1-7H,8H2,(H,20,21) |
| InChIKey | WDRYRZXSPDWGEB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.1.1 (hexokinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of hexokinase, EC 2.7.1.1, an enzyme that phosphorylates hexoses forming hexose phosphate. |
| Applications: | antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonidamine (CHEBI:50138) has role antineoplastic agent (CHEBI:35610) |
| lonidamine (CHEBI:50138) has role antispermatogenic agent (CHEBI:145047) |
| lonidamine (CHEBI:50138) has role EC 2.7.1.1 (hexokinase) inhibitor (CHEBI:78366) |
| lonidamine (CHEBI:50138) has role geroprotector (CHEBI:176497) |
| lonidamine (CHEBI:50138) is a dichlorobenzene (CHEBI:23697) |
| lonidamine (CHEBI:50138) is a indazoles (CHEBI:38769) |
| lonidamine (CHEBI:50138) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| gamendazole (CHEBI:90703) has functional parent lonidamine (CHEBI:50138) |
| IUPAC Name |
|---|
| 1-(2,4-dichlorobenzyl)-1H-indazole-3-carboxylic acid |
| INNs | Source |
|---|---|
| lonidamina | ChemIDplus |
| lonidamine | ChemIDplus |
| lonidaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2,4-dichlorbenzyl)-indazole-3-carboxylic acid | ChemIDplus |
| DICA | ChemIDplus |
| diclondazolic acid | ChemIDplus |
| Lonidamin | ChEBI |
| Brand Name | Source |
|---|---|
| Doridamina | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1598 | DrugCentral |
| D07257 | KEGG DRUG |
| DB06266 | DrugBank |
| DE2310031 | Patent |
| HMDB0254158 | HMDB |
| Lonidamine | Wikipedia |
| LSM-6272 | LINCS |
| US3895026 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:894483 | Beilstein |
| CAS:50264-69-2 | ChemIDplus |
| CAS:50264-69-2 | NIST Chemistry WebBook |
| Citations |
|---|