EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 321.163 |
| Monoisotopic Mass | 320.01193 |
| SMILES | O=C(O)c1nn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21/h1-7H,8H2,(H,20,21) |
| InChIKey | WDRYRZXSPDWGEB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.1.1 (hexokinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of hexokinase, EC 2.7.1.1, an enzyme that phosphorylates hexoses forming hexose phosphate. |
| Applications: | antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonidamine (CHEBI:50138) has role antineoplastic agent (CHEBI:35610) |
| lonidamine (CHEBI:50138) has role antispermatogenic agent (CHEBI:145047) |
| lonidamine (CHEBI:50138) has role EC 2.7.1.1 (hexokinase) inhibitor (CHEBI:78366) |
| lonidamine (CHEBI:50138) has role geroprotector (CHEBI:176497) |
| lonidamine (CHEBI:50138) is a dichlorobenzene (CHEBI:23697) |
| lonidamine (CHEBI:50138) is a indazoles (CHEBI:38769) |
| lonidamine (CHEBI:50138) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| gamendazole (CHEBI:90703) has functional parent lonidamine (CHEBI:50138) |
| IUPAC Name |
|---|
| 1-(2,4-dichlorobenzyl)-1H-indazole-3-carboxylic acid |
| INNs | Source |
|---|---|
| lonidamina | ChemIDplus |
| lonidamine | ChemIDplus |
| lonidaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2,4-dichlorbenzyl)-indazole-3-carboxylic acid | ChemIDplus |
| DICA | ChemIDplus |
| diclondazolic acid | ChemIDplus |
| Lonidamin | ChEBI |
| Brand Name | Source |
|---|---|
| Doridamina | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1598 | DrugCentral |
| D07257 | KEGG DRUG |
| DB06266 | DrugBank |
| DE2310031 | Patent |
| HMDB0254158 | HMDB |
| Lonidamine | Wikipedia |
| LSM-6272 | LINCS |
| US3895026 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:894483 | Beilstein |
| CAS:50264-69-2 | ChemIDplus |
| CAS:50264-69-2 | NIST Chemistry WebBook |
| Citations |
|---|