EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2Se |
| Net Charge | 0 |
| Average Mass | 182.081 |
| Monoisotopic Mass | 182.97985 |
| SMILES | C[Se]CC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | XDSSPSLGNGIIHP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methylselenocysteine (CHEBI:9068) has role antineoplastic agent (CHEBI:35610) |
| Se-methylselenocysteine (CHEBI:9068) has role human metabolite (CHEBI:77746) |
| Se-methylselenocysteine (CHEBI:9068) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Se-methylselenocysteine (CHEBI:9068) is a selenocysteines (CHEBI:26632) |
| Se-methylselenocysteine (CHEBI:9068) is conjugate acid of Se-methylselenocysteinate (CHEBI:53128) |
| Se-methylselenocysteine (CHEBI:9068) is conjugate base of Se-methylselenocysteinium (CHEBI:53132) |
| Incoming Relation(s) |
| γ-glutamyl-Se-methylselenocysteine (CHEBI:28776) has functional parent Se-methylselenocysteine (CHEBI:9068) |
| Se-methyl-D-selenocysteine (CHEBI:53125) is a Se-methylselenocysteine (CHEBI:9068) |
| Se-methyl-L-selenocysteine (CHEBI:27812) is a Se-methylselenocysteine (CHEBI:9068) |
| Se-methylselenocysteinium (CHEBI:53132) is conjugate acid of Se-methylselenocysteine (CHEBI:9068) |
| Se-methylselenocysteinate (CHEBI:53128) is conjugate base of Se-methylselenocysteine (CHEBI:9068) |
| Se-methylselenocysteine residue (CHEBI:53133) is substituent group from Se-methylselenocysteine (CHEBI:9068) |
| Se-methylselenocysteino group (CHEBI:53139) is substituent group from Se-methylselenocysteine (CHEBI:9068) |
| Se-methylselenocysteinyl group (CHEBI:53136) is substituent group from Se-methylselenocysteine (CHEBI:9068) |
| IUPAC Name |
|---|
| 2-amino-3-methylselanylpropanoic acid |
| Synonyms | Source |
|---|---|
| 3-(Methylseleno)alanine | ChemIDplus |
| Selenium methyl cysteine | ChemIDplus |
| Selenohomocysteine | ChemIDplus |
| Selenomethylselenocysteine | ChemIDplus |
| Se-Methyl-selenocysteine | ChemIDplus |
| Se-Methylselenocysteine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3930828 | Beilstein |
| CAS:2574-71-2 | ChemIDplus |