EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO2Se |
| Net Charge | -1 |
| Average Mass | 181.073 |
| Monoisotopic Mass | 181.97257 |
| SMILES | C[Se]CC(N)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/p-1 |
| InChIKey | XDSSPSLGNGIIHP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methylselenocysteinate (CHEBI:53128) is a α-amino-acid anion (CHEBI:33558) |
| Se-methylselenocysteinate (CHEBI:53128) is conjugate base of Se-methylselenocysteine (CHEBI:9068) |
| Incoming Relation(s) |
| Se-methyl-D-selenocysteinate (CHEBI:53129) is a Se-methylselenocysteinate (CHEBI:53128) |
| Se-methyl-L-selenocysteinate (CHEBI:53126) is a Se-methylselenocysteinate (CHEBI:53128) |
| Se-methylselenocysteine (CHEBI:9068) is conjugate acid of Se-methylselenocysteinate (CHEBI:53128) |
| IUPAC Name |
|---|
| 2-amino-3-(methylselanyl)propanoate |