EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO3 |
| Net Charge | 0 |
| Average Mass | 269.300 |
| Monoisotopic Mass | 269.10519 |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,18)(H,19,20)/t14-/m0/s1 |
| InChIKey | NPKISZUVEBESJI-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-L-phenylalanine (CHEBI:90412) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| N-benzoyl-L-phenylalanine (CHEBI:90412) is a 2-(benzoylamino)-3-phenylpropanoic acid (CHEBI:90419) |
| N-benzoyl-L-phenylalanine (CHEBI:90412) is conjugate acid of N-benzoyl-L-phenylalaninate (CHEBI:145106) |
| N-benzoyl-L-phenylalanine (CHEBI:90412) is enantiomer of N-benzoyl-D-phenylalanine (CHEBI:90413) |
| Incoming Relation(s) |
| asperphenamate (CHEBI:145105) has functional parent N-benzoyl-L-phenylalanine (CHEBI:90412) |
| N-benzoyl-DL-phenylalanine (CHEBI:90417) has part N-benzoyl-L-phenylalanine (CHEBI:90412) |
| N-benzoyl-L-phenylalaninate (CHEBI:145106) is conjugate base of N-benzoyl-L-phenylalanine (CHEBI:90412) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) is enantiomer of N-benzoyl-L-phenylalanine (CHEBI:90412) |
| IUPAC Name |
|---|
| N-benzoyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| Bz-Phe-OH | ChEBI |
| Bz-L-Phe-OH | ChEBI |
| N-benzoyl-(S)-phenylalanine | ChEBI |
| N-benzoylphenylalanine | ChEBI |
| Nα-benzoyl-L-phenylalanine | ChEBI |
| (S)-2-benzamido-3-phenylpropanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2131801 | Reaxys |
| CAS:2566-22-5 | ChemIDplus |
| Citations |
|---|