EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO3 |
| Net Charge | 0 |
| Average Mass | 269.300 |
| Monoisotopic Mass | 269.10519 |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,18)(H,19,20)/t14-/m1/s1 |
| InChIKey | NPKISZUVEBESJI-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) has role hypoglycemic agent (CHEBI:35526) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) has role insulin secretagogue (CHEBI:90415) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) is a D-phenylalanine derivative (CHEBI:84143) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) is a 2-(benzoylamino)-3-phenylpropanoic acid (CHEBI:90419) |
| N-benzoyl-D-phenylalanine (CHEBI:90413) is enantiomer of N-benzoyl-L-phenylalanine (CHEBI:90412) |
| Incoming Relation(s) |
| N-benzoyl-DL-phenylalanine (CHEBI:90417) has part N-benzoyl-D-phenylalanine (CHEBI:90413) |
| N-benzoyl-L-phenylalanine (CHEBI:90412) is enantiomer of N-benzoyl-D-phenylalanine (CHEBI:90413) |
| IUPAC Name |
|---|
| N-benzoyl-D-phenylalanine |
| Synonyms | Source |
|---|---|
| (2R)-2-benzamido-3-phenylpropanoic acid | ChEBI |
| (2R)-2-benzamido-3-phenylpropionic acid | ChEBI |
| Bz-D-Phe-OH | ChEBI |
| N-benzoyl-(R)-phenylalanine | ChEBI |
| Nα-benzoyl-D-phenylalanine | ChEBI |
| (R)-2-benzamido-3-phenylpropanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2811418 | Reaxys |
| Citations |
|---|