EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30N2O4 |
| Net Charge | 0 |
| Average Mass | 506.602 |
| Monoisotopic Mass | 506.22056 |
| SMILES | O=C(N[C@H](COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O4/c35-30(26-17-9-3-10-18-26)33-28(21-24-13-5-1-6-14-24)23-38-32(37)29(22-25-15-7-2-8-16-25)34-31(36)27-19-11-4-12-20-27/h1-20,28-29H,21-23H2,(H,33,35)(H,34,36)/t28-,29-/m0/s1 |
| InChIKey | CVULDJMCSSACEO-VMPREFPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium spathulatum (ncbitaxon:1263194) | - | PubMed (27399232) | Strain: B35 |
| Piptadenia gonoacantha (ncbitaxon:397634) | - | PubMed (21562684) | Found in branches and leaves. |
| Ficus mucuso (ncbitaxon:309328) | bark (BTO:0001301) | PubMed (21139276) | Isolated from stem bark. |
| Aspergillus flavipes (ncbitaxon:41900) | cell suspension culture (BTO:0000221) | PubMed (875642) | Strain: ATCC 11013 |
| Penicillium brevicompactum (ncbitaxon:5074) | - | PubMed (16345939) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperphenamate (CHEBI:145105) has functional parent N-benzoyl-L-phenylalanine (CHEBI:90412) |
| asperphenamate (CHEBI:145105) has functional parent N-benzoyl-L-phenylalaninol (CHEBI:145107) |
| asperphenamate (CHEBI:145105) has role antineoplastic agent (CHEBI:35610) |
| asperphenamate (CHEBI:145105) is a L-phenylalanine derivative (CHEBI:84144) |
| asperphenamate (CHEBI:145105) is a benzamides (CHEBI:22702) |
| asperphenamate (CHEBI:145105) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| (2S)-2-benzamido-3-phenylpropyl N-benzoyl-L-phenylalaninate |
| Synonyms | Source |
|---|---|
| (2S)-2-benzamido-3-phenylpropyl (2S)-2-benzamido-3-phenylpropanoate | IUPAC |
| N-benzoyl-L-phenylalanine,2S-(benzoylamino)-3-phenylpropyl ester | ChEBI |
| auranamide | ChEBI |
| anabellamide | ChEBI |
| asjanin | ChEBI |
| UniProt Name | Source |
|---|---|
| asperphenamate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00041362 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:63631-36-7 | ChemIDplus |
| Citations |
|---|