EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14Cl2O4 |
| Net Charge | 0 |
| Average Mass | 293.146 |
| Monoisotopic Mass | 292.02691 |
| SMILES | CCCCCC(=O)c1c(O)c(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C12H14Cl2O4/c1-2-3-4-5-6(15)7-10(16)8(13)12(18)9(14)11(7)17/h16-18H,2-5H2,1H3 |
| InChIKey | WLWLDMLTAFSEDI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dictyostelium (ncbitaxon:5782) | - | PubMed (9446571) |
| Roles Classification |
|---|
| Biological Role: | eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) has role eukaryotic metabolite (CHEBI:75763) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) is a aromatic ketone (CHEBI:76224) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) is a benzenetriol (CHEBI:22707) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) is a dichlorobenzene (CHEBI:23697) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) is conjugate acid of (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:90398) |
| Incoming Relation(s) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) has functional parent (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:90398) is conjugate base of (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) |
| IUPAC Name |
|---|
| 1-(3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one |
| Synonyms | Source |
|---|---|
| 3,5-dichloro-THPH | SUBMITTER |
| Cl2-THPH | ChEBI |
| dichloro-THPH | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10184570 | Reaxys |
| CAS:118222-71-2 | Reaxys |
| Citations |
|---|