EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13Cl2O4 |
| Net Charge | -1 |
| Average Mass | 292.138 |
| Monoisotopic Mass | 291.01964 |
| SMILES | CCCCCC(=O)c1c(O)c(Cl)c([O-])c(Cl)c1O |
| InChI | InChI=1S/C12H14Cl2O4/c1-2-3-4-5-6(15)7-10(16)8(13)12(18)9(14)11(7)17/h16-18H,2-5H2,1H3/p-1 |
| InChIKey | WLWLDMLTAFSEDI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:90398) is a phenolate anion (CHEBI:50525) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:90398) is conjugate base of (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) |
| Incoming Relation(s) |
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) is conjugate acid of (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:90398) |
| IUPAC Name |
|---|
| 2,6-dichloro-4-hexanoyl-3,5-dihydroxyphenolate |
| Synonyms | Source |
|---|---|
| 3,5-dichloro-THPH(1−) | ChEBI |
| Cl2-THPH(1−) | ChEBI |
| dichloro-THPH(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one | UniProt |
| Citations |
|---|