EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16Cl2O4 |
| Net Charge | 0 |
| Average Mass | 307.173 |
| Monoisotopic Mass | 306.04256 |
| SMILES | CCCCCC(=O)c1c(O)c(Cl)c(OC)c(Cl)c1O |
| InChI | InChI=1S/C13H16Cl2O4/c1-3-4-5-6-7(16)8-11(17)9(14)13(19-2)10(15)12(8)18/h17-18H,3-6H2,1-2H3 |
| InChIKey | VUDQSRFCCHQIIU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dictyostelium (ncbitaxon:5782) | - | PubMed (9446571) |
| Roles Classification |
|---|
| Biological Roles: | eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. effector A small molecule which increases (activator) or decreases (inhibitor) the activity of an (allosteric) enzyme by binding to the enzyme at the regulatory site (which is different from the substrate-binding catalytic site). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) has functional parent (3,5-dichloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:90396) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) has role eukaryotic metabolite (CHEBI:75763) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) has role signalling molecule (CHEBI:62488) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is a dichlorobenzene (CHEBI:23697) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is a differentiation-inducing factor (CHEBI:64672) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is a monomethoxybenzene (CHEBI:25235) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is a resorcinols (CHEBI:33572) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is conjugate acid of 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one(1−) (CHEBI:90397) |
| Incoming Relation(s) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one(1−) (CHEBI:90397) is conjugate base of 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) |
| IUPAC Name |
|---|
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| Synonyms | Source |
|---|---|
| 1-((3,5-dichloro)-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone | ChemIDplus |
| C13H16Cl2O4 | SUBMITTER |
| DIF 1 | ChEBI |
| DIF-1 | SUBMITTER |
| Dif-1 (dictyostelium) | ChemIDplus |
| differentiation-inducing factor-1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Differentiation-inducing_factor | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9789620 | Reaxys |
| CAS:111050-72-7 | ChemIDplus |
| Citations |
|---|