EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO6S |
| Net Charge | 0 |
| Average Mass | 267.303 |
| Monoisotopic Mass | 267.07766 |
| SMILES | N[C@@H](CCSC[C@H]1OC(O)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C9H17NO6S/c10-4(8(13)14)1-2-17-3-5-6(11)7(12)9(15)16-5/h4-7,9,11-12,15H,1-3,10H2,(H,13,14)/t4-,5+,6+,7+,9?/m0/s1 |
| InChIKey | IQFWYNFDWRYSRA-BLELIYKESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) has functional parent D-ribofuranose (CHEBI:47013) |
| S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) is a homocysteines (CHEBI:24610) |
| S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) is tautomer of S-(5-deoxy-D-ribos-5-yl)-L-homocysteine zwitterion (CHEBI:58195) |
| Incoming Relation(s) |
| S-(5-deoxy-β-D-ribos-5-yl)-L-homocysteine (CHEBI:90364) is a S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) |
| S-(5-deoxy-D-ribos-5-yl)-L-homocysteine zwitterion (CHEBI:58195) is tautomer of S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) |
| IUPAC Name |
|---|
| S-(5-deoxy-D-ribofuranos-5-yl)-L-homocysteine |
| Synonym | Source |
|---|---|
| Ribose-5-S-homocysteine | KEGG COMPOUND |