EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18ClN4O7S2 |
| Net Charge | -1 |
| Average Mass | 562.005 |
| Monoisotopic Mass | 561.03109 |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(N=Nc3c(C)nn(-c4ccc(Cl)cc4S(=O)(=O)[O-])c3O)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN4O7S2/c1-14-3-10-19(11-4-14)37(33,34)35-18-8-6-17(7-9-18)25-26-22-15(2)27-28(23(22)29)20-12-5-16(24)13-21(20)36(30,31)32/h3-13,29H,1-2H3,(H,30,31,32)/p-1 |
| InChIKey | SZBYBGROZVFLQB-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Milling yellow 3G(1−) (CHEBI:90289) is a organosulfonate oxoanion (CHEBI:33554) |
| Milling yellow 3G(1−) (CHEBI:90289) is conjugate base of Milling yellow 3G (free acid) (CHEBI:90288) |
| Incoming Relation(s) |
| Milling yellow 3G (CHEBI:90287) has part Milling yellow 3G(1−) (CHEBI:90289) |
| Milling yellow 3G (free acid) (CHEBI:90288) is conjugate acid of Milling yellow 3G(1−) (CHEBI:90289) |
| IUPAC Name |
|---|
| 5-chloro-2-[5-hydroxy-3-methyl-4-({4-[(4-methylbenzene-1-sulfonyl)oxy]phenyl}diazenyl)-1H-pyrazol-1-yl]benzene-1-sulfonate |
| Synonym | Source |
|---|---|
| Milling yellow 3G anion | ChEBI |