EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H19ClN4O7S2 |
| Net Charge | 0 |
| Average Mass | 563.013 |
| Monoisotopic Mass | 562.03837 |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(N=Nc3c(C)nn(-c4ccc(Cl)cc4S(=O)(=O)O)c3O)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN4O7S2/c1-14-3-10-19(11-4-14)37(33,34)35-18-8-6-17(7-9-18)25-26-22-15(2)27-28(23(22)29)20-12-5-16(24)13-21(20)36(30,31)32/h3-13,29H,1-2H3,(H,30,31,32) |
| InChIKey | SZBYBGROZVFLQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Milling yellow 3G (free acid) (CHEBI:90288) has role histological dye (CHEBI:77178) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a arenesulfonic acid (CHEBI:33555) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a azobenzenes (CHEBI:22682) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a heteroaryl hydroxy compound (CHEBI:74818) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a monochlorobenzenes (CHEBI:83403) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a pyrazoles (CHEBI:26410) |
| Milling yellow 3G (free acid) (CHEBI:90288) is a tosylate ester (CHEBI:83351) |
| Milling yellow 3G (free acid) (CHEBI:90288) is conjugate acid of Milling yellow 3G(1−) (CHEBI:90289) |
| Incoming Relation(s) |
| Milling yellow 3G(1−) (CHEBI:90289) is conjugate base of Milling yellow 3G (free acid) (CHEBI:90288) |
| IUPAC Name |
|---|
| 5-chloro-2-[5-hydroxy-3-methyl-4-({4-[(4-methylbenzene-1-sulfonyl)oxy]phenyl}diazenyl)-1H-pyrazol-1-yl]benzene-1-sulfonic acid |
| Synonym | Source |
|---|---|
| Milling yellow 3G acid form | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:968809 | Reaxys |