EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18ClN4O7S2.Na |
| Net Charge | 0 |
| Average Mass | 584.995 |
| Monoisotopic Mass | 584.02031 |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(N=Nc3c(C)nn(-c4ccc(Cl)cc4S(=O)(=O)[O-])c3O)cc2)cc1.[Na+] |
| InChI | InChI=1S/C23H19ClN4O7S2.Na/c1-14-3-10-19(11-4-14)37(33,34)35-18-8-6-17(7-9-18)25-26-22-15(2)27-28(23(22)29)20-12-5-16(24)13-21(20)36(30,31)32;/h3-13,29H,1-2H3,(H,30,31,32);/q;+1/p-1 |
| InChIKey | UMQAIKKJIZYHQC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Milling yellow 3G (CHEBI:90287) has part Milling yellow 3G(1−) (CHEBI:90289) |
| Milling yellow 3G (CHEBI:90287) has role histological dye (CHEBI:77178) |
| Milling yellow 3G (CHEBI:90287) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 5-chloro-2-[5-hydroxy-3-methyl-4-({4-[(4-methylbenzene-1-sulfonyl)oxy]phenyl}diazenyl)-1H-pyrazol-1-yl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| acid yellow 40 | ChEBI |
| C.I. 18950 | ChEBI |
| C.I. 642 | ChemIDplus |
| C.I. Acid Yellow 40 | ChemIDplus |
| C.I. Acid Yellow 40 monosodium salt | ChemIDplus |
| C.I. Acid Yellow 40, sodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:6372-96-9 | ChemIDplus |